C38H33N3O4S — CID 89043685
methyl 3-[4-[(2-nitrophenyl)sulfanyl-[[4-[(2-phenylindol-1-yl)methyl]phenyl]methyl]amino]phenyl]propanoate (PubChem CID 89043685) has the molecular formula C38H33N3O4S and a molecular weight of 627.77 g/mol. Its IUPAC name is methyl 3-[4-[(2-nitrophenyl)sulfanyl-[[4-[(2-phenylindol-1-yl)methyl]phenyl]methyl]amino]phenyl]propanoate.
| Compound Name | methyl 3-[4-[(2-nitrophenyl)sulfanyl-[[4-[(2-phenylindol-1-yl)methyl]phenyl]methyl]amino]phenyl]propanoate |
|---|---|
| PubChem CID | 89043685 |
| Molecular Formula | C38H33N3O4S |
| Molecular Weight | 627.77 g/mol |
| Exact Mass | 627.22 |
| IUPAC Name | methyl 3-[4-[(2-nitrophenyl)sulfanyl-[[4-[(2-phenylindol-1-yl)methyl]phenyl]methyl]amino]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(N(Cc2ccc(Cn3c(-c4ccccc4)cc4ccccc43)cc2)Sc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C38H33N3O4S/c1-45-38(42)24-21-28-19-22-33(23-20-28)40(46-37-14-8-7-13-35(37)41(43)44)27-30-17-15-29(16-18-30)26-39-34-12-6-5-11-32(34)25-36(39)31-9-3-2-4-10-31/h2-20,22-23,25H,21,24,26-27H2,1H3 |
| InChIKey | GFOGVSXTJXAMLD-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 77.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.77 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|