C13H17N3O — CID 89044528
2-[(3E,5Z)-6-aminohepta-1,3,5-trien-4-yl]-6-methoxypyridin-4-amine (PubChem CID 89044528) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-[(3E,5Z)-6-aminohepta-1,3,5-trien-4-yl]-6-methoxypyridin-4-amine.
| Compound Name | 2-[(3E,5Z)-6-aminohepta-1,3,5-trien-4-yl]-6-methoxypyridin-4-amine |
|---|---|
| PubChem CID | 89044528 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-[(3E,5Z)-6-aminohepta-1,3,5-trien-4-yl]-6-methoxypyridin-4-amine |
| SMILES | C=C/C=C(\C=C(\C)N)c1cc(N)cc(OC)n1 |
| InChI | InChI=1S/C13H17N3O/c1-4-5-10(6-9(2)14)12-7-11(15)8-13(16-12)17-3/h4-8H,1,14H2,2-3H3,(H2,15,16)/b9-6-,10-5+ |
| InChIKey | BJIGXCYMSCJFKS-SCWCTGRGSA-N |
| XLogP | 2.10 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|