C19H23ClN4O4S — CID 89047207
1-[(2-chloro-2,3-dihydrothiophene-5-carbonyl)amino]-3-[4-(3-oxomorpholin-4-yl)phenyl]-1-propylurea (PubChem CID 89047207) has the molecular formula C19H23ClN4O4S and a molecular weight of 438.94 g/mol. Its IUPAC name is 1-[(2-chloro-2,3-dihydrothiophene-5-carbonyl)amino]-3-[4-(3-oxomorpholin-4-yl)phenyl]-1-propylurea.
| Compound Name | 1-[(2-chloro-2,3-dihydrothiophene-5-carbonyl)amino]-3-[4-(3-oxomorpholin-4-yl)phenyl]-1-propylurea |
|---|---|
| PubChem CID | 89047207 |
| Molecular Formula | C19H23ClN4O4S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 1-[(2-chloro-2,3-dihydrothiophene-5-carbonyl)amino]-3-[4-(3-oxomorpholin-4-yl)phenyl]-1-propylurea |
| SMILES | CCCN(NC(=O)C1=CCC(Cl)S1)C(=O)Nc1ccc(N2CCOCC2=O)cc1 |
| InChI | InChI=1S/C19H23ClN4O4S/c1-2-9-24(22-18(26)15-7-8-16(20)29-15)19(27)21-13-3-5-14(6-4-13)23-10-11-28-12-17(23)25/h3-7,16H,2,8-12H2,1H3,(H,21,27)(H,22,26) |
| InChIKey | YGBDXHFBRODBHB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|