C18H19N3O5S — CID 110363646
N-[4-[[4-(3-oxomorpholin-4-yl)phenyl]sulfamoyl]phenyl]acetamide (PubChem CID 110363646) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is N-[4-[[4-(3-oxomorpholin-4-yl)phenyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[4-(3-oxomorpholin-4-yl)phenyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 110363646 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-[4-[[4-(3-oxomorpholin-4-yl)phenyl]sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc(N3CCOCC3=O)cc2)cc1 |
| InChI | InChI=1S/C18H19N3O5S/c1-13(22)19-14-4-8-17(9-5-14)27(24,25)20-15-2-6-16(7-3-15)21-10-11-26-12-18(21)23/h2-9,20H,10-12H2,1H3,(H,19,22) |
| InChIKey | UDIFNNPBIOQGHR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |