C17H16N2O5S — CID 110372382
N-(4-acetylphenyl)-4-(2-oxo-1,3-oxazolidin-3-yl)benzenesulfonamide (PubChem CID 110372382) has the molecular formula C17H16N2O5S and a molecular weight of 360.39 g/mol. Its IUPAC name is N-(4-acetylphenyl)-4-(2-oxo-1,3-oxazolidin-3-yl)benzenesulfonamide.
| Compound Name | N-(4-acetylphenyl)-4-(2-oxo-1,3-oxazolidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110372382 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-(4-acetylphenyl)-4-(2-oxo-1,3-oxazolidin-3-yl)benzenesulfonamide |
| SMILES | CC(=O)c1ccc(NS(=O)(=O)c2ccc(N3CCOC3=O)cc2)cc1 |
| InChI | InChI=1S/C17H16N2O5S/c1-12(20)13-2-4-14(5-3-13)18-25(22,23)16-8-6-15(7-9-16)19-10-11-24-17(19)21/h2-9,18H,10-11H2,1H3 |
| InChIKey | TUKZZOIUEWFGHC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |