C15H16N2O4S2 — CID 110363635
5-methyl-N-[4-(3-oxomorpholin-4-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 110363635) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 5-methyl-N-[4-(3-oxomorpholin-4-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[4-(3-oxomorpholin-4-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110363635 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 5-methyl-N-[4-(3-oxomorpholin-4-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCOCC3=O)cc2)s1 |
| InChI | InChI=1S/C15H16N2O4S2/c1-11-2-7-15(22-11)23(19,20)16-12-3-5-13(6-4-12)17-8-9-21-10-14(17)18/h2-7,16H,8-10H2,1H3 |
| InChIKey | WJLVYKYLKZWXLT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |