C17H22N2O3S2 — CID 136525099
5-methyl-N-[4-(1-morpholin-4-ylethyl)phenyl]thiophene-2-sulfonamide (PubChem CID 136525099) has the molecular formula C17H22N2O3S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 5-methyl-N-[4-(1-morpholin-4-ylethyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[4-(1-morpholin-4-ylethyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 136525099 |
| Molecular Formula | C17H22N2O3S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 5-methyl-N-[4-(1-morpholin-4-ylethyl)phenyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(C)N3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C17H22N2O3S2/c1-13-3-8-17(23-13)24(20,21)18-16-6-4-15(5-7-16)14(2)19-9-11-22-12-10-19/h3-8,14,18H,9-12H2,1-2H3 |
| InChIKey | PRNYDQFCIJGNAP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |