C16H23NO7 — CID 89047761
6-(dihydroxyamino)oxyhexyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 89047761) has the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. Its IUPAC name is 6-(dihydroxyamino)oxyhexyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | 6-(dihydroxyamino)oxyhexyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 89047761 |
| Molecular Formula | C16H23NO7 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 6-(dihydroxyamino)oxyhexyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCCCCCCON(O)O)ccc1O |
| InChI | InChI=1S/C16H23NO7/c1-22-15-12-13(6-8-14(15)18)7-9-16(19)23-10-4-2-3-5-11-24-17(20)21/h6-9,12,18,20-21H,2-5,10-11H2,1H3/b9-7+ |
| InChIKey | NGOVNAXUYCQOQT-VQHVLOKHSA-N |
| XLogP | 2.53 |
| TPSA | 108.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|