3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid

C7H13NO2S — CID 89049247

IUPAC3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid
SMILESCN1CSC(C)(C)C1C(=O)O
InChIInChI=1S/C7H13NO2S/c1-7(2)5(6(9)10)8(3)4-11-7/h5H,4H2,1-3H3,(H,9,10)
InChIKeyNWAITXJQZNBRGI-UHFFFAOYSA-N
MW175.25 g/mol
LogP0.85
Rot. Bonds1

About 3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid

3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 89049247) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is 3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid.

Molecular Properties

Compound Name3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid
PubChem CID89049247
Molecular FormulaC7H13NO2S
Molecular Weight175.25 g/mol
Exact Mass175.07
IUPAC Name3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid
SMILESCN1CSC(C)(C)C1C(=O)O
InChIInChI=1S/C7H13NO2S/c1-7(2)5(6(9)10)8(3)4-11-7/h5H,4H2,1-3H3,(H,9,10)
InChIKeyNWAITXJQZNBRGI-UHFFFAOYSA-N
XLogP0.85
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500175.25
LogP ≤ 50.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid (CID 89049247) is 3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid is CN1CSC(C)(C)C1C(=O)O.
What is the InChIKey of 3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is NWAITXJQZNBRGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-7(2)5(6(9)10)8(3)4-11-7/h5H,4H2,1-3H3,(H,9,10).
What are the key properties of 3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid?
3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 175.25 g/mol, XLogP of 0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5,5-trimethyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 89049247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).