C19H24ClNO3 — CID 89049493
ethyl 2-[(E)-2-(4-chloro-2-propanoylphenyl)ethenyl]-5-methylpyrrolidine-1-carboxylate (PubChem CID 89049493) has the molecular formula C19H24ClNO3 and a molecular weight of 349.86 g/mol. Its IUPAC name is ethyl 2-[(E)-2-(4-chloro-2-propanoylphenyl)ethenyl]-5-methylpyrrolidine-1-carboxylate.
| Compound Name | ethyl 2-[(E)-2-(4-chloro-2-propanoylphenyl)ethenyl]-5-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 89049493 |
| Molecular Formula | C19H24ClNO3 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | ethyl 2-[(E)-2-(4-chloro-2-propanoylphenyl)ethenyl]-5-methylpyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1C(C)CCC1/C=C/c1ccc(Cl)cc1C(=O)CC |
| InChI | InChI=1S/C19H24ClNO3/c1-4-18(22)17-12-15(20)9-7-14(17)8-11-16-10-6-13(3)21(16)19(23)24-5-2/h7-9,11-13,16H,4-6,10H2,1-3H3/b11-8+ |
| InChIKey | HYGZIMGDXHJITN-DHZHZOJOSA-N |
| XLogP | 4.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |