C20H26ClNO2 — CID 142948096
ethyl 3-(2-but-1-en-2-yl-4-chlorophenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 142948096) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is ethyl 3-(2-but-1-en-2-yl-4-chlorophenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | ethyl 3-(2-but-1-en-2-yl-4-chlorophenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 142948096 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | ethyl 3-(2-but-1-en-2-yl-4-chlorophenyl)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | C=C(CC)c1cc(Cl)ccc1C1CC2CCC(C1)N2C(=O)OCC |
| InChI | InChI=1S/C20H26ClNO2/c1-4-13(3)19-12-15(21)6-9-18(19)14-10-16-7-8-17(11-14)22(16)20(23)24-5-2/h6,9,12,14,16-17H,3-5,7-8,10-11H2,1-2H3 |
| InChIKey | HKEZLHLRVQPTRH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |