C25H30O2 — CID 89049681
1-[4-[4-(4-ethenylcyclohexyl)phenyl]-2-hydroxyphenyl]pentan-1-one (PubChem CID 89049681) has the molecular formula C25H30O2 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1-[4-[4-(4-ethenylcyclohexyl)phenyl]-2-hydroxyphenyl]pentan-1-one.
| Compound Name | 1-[4-[4-(4-ethenylcyclohexyl)phenyl]-2-hydroxyphenyl]pentan-1-one |
|---|---|
| PubChem CID | 89049681 |
| Molecular Formula | C25H30O2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 1-[4-[4-(4-ethenylcyclohexyl)phenyl]-2-hydroxyphenyl]pentan-1-one |
| SMILES | C=CC1CCC(c2ccc(-c3ccc(C(=O)CCCC)c(O)c3)cc2)CC1 |
| InChI | InChI=1S/C25H30O2/c1-3-5-6-24(26)23-16-15-22(17-25(23)27)21-13-11-20(12-14-21)19-9-7-18(4-2)8-10-19/h4,11-19,27H,2-3,5-10H2,1H3 |
| InChIKey | BHFFABJKMWLGMT-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|