C20H21N4O4S- — CID 89050716
CID 89050716 (PubChem CID 89050716) has the molecular formula C20H21N4O4S- and a molecular weight of 413.48 g/mol.
| Compound Name | CID 89050716 |
|---|---|
| PubChem CID | 89050716 |
| Molecular Formula | C20H21N4O4S- |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | — |
| SMILES | CCNCCNC(=O)C/[S-](=O)=N/C(=O)c1cncc(C#Cc2cccc(O)c2)c1 |
| InChI | InChI=1S/C20H21N4O4S/c1-2-21-8-9-23-19(26)14-29(28)24-20(27)17-10-16(12-22-13-17)7-6-15-4-3-5-18(25)11-15/h3-5,10-13,21,25H,2,8-9,14H2,1H3,(H,23,26)/q-1 |
| InChIKey | SSFDDVJEPZZRRW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|