C21H24FN2O2+ — CID 8905141
[(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl]-cyclopropyl-[(4-fluorophenyl)methyl]azanium (PubChem CID 8905141) has the molecular formula C21H24FN2O2+ and a molecular weight of 355.43 g/mol. Its IUPAC name is [(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl]-cyclopropyl-[(4-fluorophenyl)methyl]azanium.
| Compound Name | [(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl]-cyclopropyl-[(4-fluorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 8905141 |
| Molecular Formula | C21H24FN2O2+ |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [(2R)-1-(4-acetylanilino)-1-oxopropan-2-yl]-cyclopropyl-[(4-fluorophenyl)methyl]azanium |
| SMILES | CC(=O)c1ccc(NC(=O)[C@@H](C)[NH+](Cc2ccc(F)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C21H23FN2O2/c1-14(21(26)23-19-9-5-17(6-10-19)15(2)25)24(20-11-12-20)13-16-3-7-18(22)8-4-16/h3-10,14,20H,11-13H2,1-2H3,(H,23,26)/p+1/t14-/m1/s1 |
| InChIKey | WZFHIZYTASQBRL-CQSZACIVSA-O |
| XLogP | 2.60 |
| TPSA | 50.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |