C18H17N3O — CID 89052951
1-(3-aminophenyl)-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethanol (PubChem CID 89052951) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-(3-aminophenyl)-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethanol.
| Compound Name | 1-(3-aminophenyl)-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethanol |
|---|---|
| PubChem CID | 89052951 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-(3-aminophenyl)-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethanol |
| SMILES | Nc1cccc(C(O)CC2c3ccccc3-c3cncn32)c1 |
| InChI | InChI=1S/C18H17N3O/c19-13-5-3-4-12(8-13)18(22)9-16-14-6-1-2-7-15(14)17-10-20-11-21(16)17/h1-8,10-11,16,18,22H,9,19H2 |
| InChIKey | XKHZICCQURTELE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|