C7H11N3 — CID 89053427
2-ethyl-3-methyl-1,3,5-triazepine (PubChem CID 89053427) has the molecular formula C7H11N3 and a molecular weight of 137.19 g/mol. Its IUPAC name is 2-ethyl-3-methyl-1,3,5-triazepine.
| Compound Name | 2-ethyl-3-methyl-1,3,5-triazepine |
|---|---|
| PubChem CID | 89053427 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 2-ethyl-3-methyl-1,3,5-triazepine |
| SMILES | CCC1=NC=CN=CN1C |
| InChI | InChI=1S/C7H11N3/c1-3-7-9-5-4-8-6-10(7)2/h4-6H,3H2,1-2H3 |
| InChIKey | GCYQOYUDUPSPHK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |