C23H30O3 — CID 89053699
6-[1-(2-bicyclo[2.2.1]hepta-2,5-dienyl)ethenoxy]hexyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 89053699) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 6-[1-(2-bicyclo[2.2.1]hepta-2,5-dienyl)ethenoxy]hexyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 6-[1-(2-bicyclo[2.2.1]hepta-2,5-dienyl)ethenoxy]hexyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 89053699 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 6-[1-(2-bicyclo[2.2.1]hepta-2,5-dienyl)ethenoxy]hexyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | C=C(OCCCCCCOC(=O)C1CC2C=CC1C2)C1=CC2C=CC1C2 |
| InChI | InChI=1S/C23H30O3/c1-16(21-14-17-6-8-19(21)12-17)25-10-4-2-3-5-11-26-23(24)22-15-18-7-9-20(22)13-18/h6-9,14,17-20,22H,1-5,10-13,15H2 |
| InChIKey | FPWOHBNOUYCSSF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|