C16H22O3 — CID 20714528
2-bicyclo[2.2.1]hept-5-enylmethyl 2-methoxycyclohexene-1-carboxylate (PubChem CID 20714528) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enylmethyl 2-methoxycyclohexene-1-carboxylate.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enylmethyl 2-methoxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 20714528 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enylmethyl 2-methoxycyclohexene-1-carboxylate |
| SMILES | COC1=C(C(=O)OCC2CC3C=CC2C3)CCCC1 |
| InChI | InChI=1S/C16H22O3/c1-18-15-5-3-2-4-14(15)16(17)19-10-13-9-11-6-7-12(13)8-11/h6-7,11-13H,2-5,8-10H2,1H3 |
| InChIKey | JSQXPKGPENGDKO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|