C20H31O3- — CID 135047755
(3aS,7aR)-1-[(Z)-4,5-dimethylhex-2-en-2-yl]-5-methoxycarbonyl-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-olate (PubChem CID 135047755) has the molecular formula C20H31O3- and a molecular weight of 319.47 g/mol. Its IUPAC name is (3aS,7aR)-1-[(Z)-4,5-dimethylhex-2-en-2-yl]-5-methoxycarbonyl-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-olate.
| Compound Name | (3aS,7aR)-1-[(Z)-4,5-dimethylhex-2-en-2-yl]-5-methoxycarbonyl-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-olate |
|---|---|
| PubChem CID | 135047755 |
| Molecular Formula | C20H31O3- |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (3aS,7aR)-1-[(Z)-4,5-dimethylhex-2-en-2-yl]-5-methoxycarbonyl-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-olate |
| SMILES | COC(=O)C1=C([O-])[C@H]2CCC(/C(C)=C\C(C)C(C)C)[C@@]2(C)CC1 |
| InChI | InChI=1S/C20H32O3/c1-12(2)13(3)11-14(4)16-7-8-17-18(21)15(19(22)23-6)9-10-20(16,17)5/h11-13,16-17,21H,7-10H2,1-6H3/p-1/b14-11-/t13?,16?,17-,20-/m1/s1 |
| InChIKey | HDEKGURNVKEBIB-HLNNJFBKSA-M |
| XLogP | 3.84 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|