C23H28N8O2 — CID 89054218
1-[2-[3-[5-[2-(dimethylamino)ethoxy]pyrimidin-2-yl]phenyl]ethanimidoyl]-6-imino-N,N-dimethylpyridazine-3-carboxamide (PubChem CID 89054218) has the molecular formula C23H28N8O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is 1-[2-[3-[5-[2-(dimethylamino)ethoxy]pyrimidin-2-yl]phenyl]ethanimidoyl]-6-imino-N,N-dimethylpyridazine-3-carboxamide.
| Compound Name | 1-[2-[3-[5-[2-(dimethylamino)ethoxy]pyrimidin-2-yl]phenyl]ethanimidoyl]-6-imino-N,N-dimethylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 89054218 |
| Molecular Formula | C23H28N8O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 1-[2-[3-[5-[2-(dimethylamino)ethoxy]pyrimidin-2-yl]phenyl]ethanimidoyl]-6-imino-N,N-dimethylpyridazine-3-carboxamide |
| SMILES | [H]/N=C(\Cc1cccc(-c2ncc(OCCN(C)C)cn2)c1)n1nc(C(=O)N(C)C)cc/c1=N\[H] |
| InChI | InChI=1S/C23H28N8O2/c1-29(2)10-11-33-18-14-26-22(27-15-18)17-7-5-6-16(12-17)13-21(25)31-20(24)9-8-19(28-31)23(32)30(3)4/h5-9,12,14-15,24-25H,10-11,13H2,1-4H3/b24-20+,25-21+ |
| InChIKey | VLUBXVMDMNDPLU-CTWPWMDCSA-N |
| XLogP | 1.53 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|