2-[acetamido(methyl)amino]acetic acid

C5H10N2O3 — CID 89054986

IUPAC2-[acetamido(methyl)amino]acetic acid
SMILESCC(=O)NN(C)CC(=O)O
InChIInChI=1S/C5H10N2O3/c1-4(8)6-7(2)3-5(9)10/h3H2,1-2H3,(H,6,8)(H,9,10)
InChIKeyUUXLRSWBJDMGSD-UHFFFAOYSA-N
MW146.15 g/mol
LogP-0.95
Rot. Bonds3

About 2-[acetamido(methyl)amino]acetic acid

2-[acetamido(methyl)amino]acetic acid (PubChem CID 89054986) has the molecular formula C5H10N2O3 and a molecular weight of 146.15 g/mol. Its IUPAC name is 2-[acetamido(methyl)amino]acetic acid.

Molecular Properties

Compound Name2-[acetamido(methyl)amino]acetic acid
PubChem CID89054986
Molecular FormulaC5H10N2O3
Molecular Weight146.15 g/mol
Exact Mass146.07
IUPAC Name2-[acetamido(methyl)amino]acetic acid
SMILESCC(=O)NN(C)CC(=O)O
InChIInChI=1S/C5H10N2O3/c1-4(8)6-7(2)3-5(9)10/h3H2,1-2H3,(H,6,8)(H,9,10)
InChIKeyUUXLRSWBJDMGSD-UHFFFAOYSA-N
XLogP-0.95
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.15
LogP ≤ 5-0.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[acetamido(methyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[Acetamido(carboxymethyl)amino]acetic acid
CID 19352930
2-[Acetamido-(2-aminoacetyl)amino]acetic acid
CID 123605952
2-[Carboxymethyl-(2-methylpropanoylamino)amino]acetic acid
CID 22373803
2-[Acetamido(ethyl)amino]acetic acid
CID 22558290
2-(2-Acetylhydrazinyl)acetic acid
CID 23171574
2-[Ethyl(ethylamino)amino]acetic acid
CID 23206153
2-[Carboxymethyl-(oxaldehydoylamino)amino]acetic acid
CID 57123691
2-(2,2-Diethylhydrazinyl)-2-oxoacetic acid
CID 87103228
2-(Diacetamidoamino)acetic acid
CID 87876614
2-[Methyl(methylamino)amino]acetic acid
CID 87884625
2-[Acetyl(amino)amino]acetic acid
CID 88241806
(Carbonochloridoylamino)-(carboxymethyl)-dimethylazanium
CID 91535684

Frequently Asked Questions

What is the IUPAC name of 2-[acetamido(methyl)amino]acetic acid?
The IUPAC name of 2-[acetamido(methyl)amino]acetic acid (CID 89054986) is 2-[acetamido(methyl)amino]acetic acid.
What is the SMILES notation for 2-[acetamido(methyl)amino]acetic acid?
The canonical SMILES for 2-[acetamido(methyl)amino]acetic acid is CC(=O)NN(C)CC(=O)O.
What is the InChIKey of 2-[acetamido(methyl)amino]acetic acid?
The InChIKey is UUXLRSWBJDMGSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O3/c1-4(8)6-7(2)3-5(9)10/h3H2,1-2H3,(H,6,8)(H,9,10).
What are the key properties of 2-[acetamido(methyl)amino]acetic acid?
2-[acetamido(methyl)amino]acetic acid has a molecular weight of 146.15 g/mol, XLogP of -0.95, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[acetamido(methyl)amino]acetic acid is sourced from PubChem (CID 89054986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).