C29H33N3O4S2 — CID 89056988
9H-fluoren-9-ylmethyl N-[(2S)-1-[[(3S)-1-cyano-5-methylsulfanyl-2-oxo-1-(thiolan-1-ylidene)pentan-3-yl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 89056988) has the molecular formula C29H33N3O4S2 and a molecular weight of 551.73 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-[[(3S)-1-cyano-5-methylsulfanyl-2-oxo-1-(thiolan-1-ylidene)pentan-3-yl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[[(3S)-1-cyano-5-methylsulfanyl-2-oxo-1-(thiolan-1-ylidene)pentan-3-yl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 89056988 |
| Molecular Formula | C29H33N3O4S2 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[[(3S)-1-cyano-5-methylsulfanyl-2-oxo-1-(thiolan-1-ylidene)pentan-3-yl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CSCC[C@H](NC(=O)[C@H](C)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)C(C#N)=S1CCCC1 |
| InChI | InChI=1S/C29H33N3O4S2/c1-19(28(34)32-25(13-14-37-2)27(33)26(17-30)38-15-7-8-16-38)31-29(35)36-18-24-22-11-5-3-9-20(22)21-10-4-6-12-23(21)24/h3-6,9-12,19,24-25H,7-8,13-16,18H2,1-2H3,(H,31,35)(H,32,34)/t19-,25-/m0/s1 |
| InChIKey | GRWJPPHWJJSTRZ-DFBJGRDBSA-N |
| XLogP | 4.48 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|