C34H30N2O3PS+ — CID 101255443
[(3S)-1-cyano-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methylsulfanyl-2-oxopentylidene]-diphenylphosphanium (PubChem CID 101255443) has the molecular formula C34H30N2O3PS+ and a molecular weight of 577.67 g/mol. Its IUPAC name is [(3S)-1-cyano-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methylsulfanyl-2-oxopentylidene]-diphenylphosphanium.
| Compound Name | [(3S)-1-cyano-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methylsulfanyl-2-oxopentylidene]-diphenylphosphanium |
|---|---|
| PubChem CID | 101255443 |
| Molecular Formula | C34H30N2O3PS+ |
| Molecular Weight | 577.67 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | [(3S)-1-cyano-3-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methylsulfanyl-2-oxopentylidene]-diphenylphosphanium |
| SMILES | CSCC[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)C(C#N)=[P+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H29N2O3PS/c1-41-21-20-31(33(37)32(22-35)40(24-12-4-2-5-13-24)25-14-6-3-7-15-25)36-34(38)39-23-30-28-18-10-8-16-26(28)27-17-9-11-19-29(27)30/h2-19,30-31H,20-21,23H2,1H3/p+1/t31-/m0/s1 |
| InChIKey | IORZPAQNVNJDCR-HKBQPEDESA-O |
| XLogP | 6.04 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.67 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|