C21H21N3O3S — CID 87926960
9H-fluoren-9-ylmethyl N-[1-[cyano(methyl)amino]-3-methylsulfanyl-1-oxopropan-2-yl]carbamate (PubChem CID 87926960) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[1-[cyano(methyl)amino]-3-methylsulfanyl-1-oxopropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[1-[cyano(methyl)amino]-3-methylsulfanyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87926960 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[1-[cyano(methyl)amino]-3-methylsulfanyl-1-oxopropan-2-yl]carbamate |
| SMILES | CSCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N(C)C#N |
| InChI | InChI=1S/C21H21N3O3S/c1-24(13-22)20(25)19(12-28-2)23-21(26)27-11-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,18-19H,11-12H2,1-2H3,(H,23,26) |
| InChIKey | FUIXDNXHPGOHAM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|