C21H22FN5O4 — CID 89058223
6-[amino-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]methyl]-4-(2-fluoroethyl)-8-methoxy-1,4-benzoxazin-3-one (PubChem CID 89058223) has the molecular formula C21H22FN5O4 and a molecular weight of 427.44 g/mol. Its IUPAC name is 6-[amino-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]methyl]-4-(2-fluoroethyl)-8-methoxy-1,4-benzoxazin-3-one.
| Compound Name | 6-[amino-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]methyl]-4-(2-fluoroethyl)-8-methoxy-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 89058223 |
| Molecular Formula | C21H22FN5O4 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 6-[amino-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]methyl]-4-(2-fluoroethyl)-8-methoxy-1,4-benzoxazin-3-one |
| SMILES | COc1cc(C(N)Nc2ccc(-c3noc(C)n3)cc2)cc2c1OCC(=O)N2CCF |
| InChI | InChI=1S/C21H22FN5O4/c1-12-24-21(26-31-12)13-3-5-15(6-4-13)25-20(23)14-9-16-19(17(10-14)29-2)30-11-18(28)27(16)8-7-22/h3-6,9-10,20,25H,7-8,11,23H2,1-2H3 |
| InChIKey | HARULIZGWPISMW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|