C20H21FN4O3S — CID 59516937
methyl 2-(2-fluoro-4,5-dimethoxyphenyl)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]ethanimidothioate (PubChem CID 59516937) has the molecular formula C20H21FN4O3S and a molecular weight of 416.48 g/mol. Its IUPAC name is methyl 2-(2-fluoro-4,5-dimethoxyphenyl)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]ethanimidothioate.
| Compound Name | methyl 2-(2-fluoro-4,5-dimethoxyphenyl)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]ethanimidothioate |
|---|---|
| PubChem CID | 59516937 |
| Molecular Formula | C20H21FN4O3S |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | methyl 2-(2-fluoro-4,5-dimethoxyphenyl)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]ethanimidothioate |
| SMILES | [H]/N=C(\SC)C(Nc1ccc(-c2noc(C)n2)cc1)c1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C20H21FN4O3S/c1-11-23-20(25-28-11)12-5-7-13(8-6-12)24-18(19(22)29-4)14-9-16(26-2)17(27-3)10-15(14)21/h5-10,18,22,24H,1-4H3/b22-19- |
| InChIKey | WDCSNBZUGNZUOK-QOCHGBHMSA-N |
| XLogP | 4.69 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|