C27H34N4O5SSi — CID 59517416
methyl (1Z)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-N-methoxycarbonyl-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]iminoethanimidothioate (PubChem CID 59517416) has the molecular formula C27H34N4O5SSi and a molecular weight of 554.75 g/mol. Its IUPAC name is methyl (1Z)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-N-methoxycarbonyl-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]iminoethanimidothioate.
| Compound Name | methyl (1Z)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-N-methoxycarbonyl-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]iminoethanimidothioate |
|---|---|
| PubChem CID | 59517416 |
| Molecular Formula | C27H34N4O5SSi |
| Molecular Weight | 554.75 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | methyl (1Z)-2-[4-[tert-butyl(dimethyl)silyl]oxy-3-methoxyphenyl]-N-methoxycarbonyl-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]iminoethanimidothioate |
| SMILES | COC(=O)/N=C(SC)/C(=N\c1ccc(-c2noc(C)n2)cc1)c1ccc(O[Si](C)(C)C(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C27H34N4O5SSi/c1-17-28-24(31-35-17)18-10-13-20(14-11-18)29-23(25(37-7)30-26(32)34-6)19-12-15-21(22(16-19)33-5)36-38(8,9)27(2,3)4/h10-16H,1-9H3/b29-23-,30-25- |
| InChIKey | AUORNQSTJTTYLN-UGLMQBQPSA-N |
| XLogP | 7.09 |
| TPSA | 108.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.75 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|