C27H33N4O5SSi — CID 140522168
CID 140522168 (PubChem CID 140522168) has the molecular formula C27H33N4O5SSi and a molecular weight of 553.74 g/mol.
| Compound Name | CID 140522168 |
|---|---|
| PubChem CID | 140522168 |
| Molecular Formula | C27H33N4O5SSi |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | — |
| SMILES | COC(=O)N=C(SC)/C(=N\c1ccc(-c2noc(C)n2)cc1)c1ccc(C(C)(C)C)c(OC)c1O[Si](C)C |
| InChI | InChI=1S/C27H33N4O5SSi/c1-16-28-24(31-35-16)17-10-12-18(13-11-17)29-21(25(37-7)30-26(32)34-6)19-14-15-20(27(2,3)4)23(33-5)22(19)36-38(8)9/h10-15H,1-9H3/b29-21-,30-25? |
| InChIKey | YTSAGOYIQISBBS-ZIRPROKMSA-N |
| XLogP | 6.63 |
| TPSA | 108.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|