C23H22N4O5S — CID 152717715
[2-(8-ethyl-4H-1,3-benzodioxin-6-yl)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]imino-1-methylsulfanylethylidene]carbamic acid (PubChem CID 152717715) has the molecular formula C23H22N4O5S and a molecular weight of 466.52 g/mol. Its IUPAC name is [2-(8-ethyl-4H-1,3-benzodioxin-6-yl)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]imino-1-methylsulfanylethylidene]carbamic acid.
| Compound Name | [2-(8-ethyl-4H-1,3-benzodioxin-6-yl)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]imino-1-methylsulfanylethylidene]carbamic acid |
|---|---|
| PubChem CID | 152717715 |
| Molecular Formula | C23H22N4O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [2-(8-ethyl-4H-1,3-benzodioxin-6-yl)-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]imino-1-methylsulfanylethylidene]carbamic acid |
| SMILES | CCc1cc(/C(=N/c2ccc(-c3noc(C)n3)cc2)C(=NC(=O)O)SC)cc2c1OCOC2 |
| InChI | InChI=1S/C23H22N4O5S/c1-4-14-9-16(10-17-11-30-12-31-20(14)17)19(22(33-3)26-23(28)29)25-18-7-5-15(6-8-18)21-24-13(2)32-27-21/h5-10H,4,11-12H2,1-3H3,(H,28,29)/b25-19-,26-22? |
| InChIKey | ZUYNWMZYDSEKSQ-OLNWEDNXSA-N |
| XLogP | 5.03 |
| TPSA | 119.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|