C33H46N4O6SSi — CID 87267681
methyl 2-[3,4-dimethoxy-5-[1-tri(propan-2-yl)silyloxyethyl]phenyl]-N-methoxycarbonyl-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]iminoethanimidothioate (PubChem CID 87267681) has the molecular formula C33H46N4O6SSi and a molecular weight of 654.91 g/mol. Its IUPAC name is methyl 2-[3,4-dimethoxy-5-[1-tri(propan-2-yl)silyloxyethyl]phenyl]-N-methoxycarbonyl-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]iminoethanimidothioate.
| Compound Name | methyl 2-[3,4-dimethoxy-5-[1-tri(propan-2-yl)silyloxyethyl]phenyl]-N-methoxycarbonyl-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]iminoethanimidothioate |
|---|---|
| PubChem CID | 87267681 |
| Molecular Formula | C33H46N4O6SSi |
| Molecular Weight | 654.91 g/mol |
| Exact Mass | 654.29 |
| IUPAC Name | methyl 2-[3,4-dimethoxy-5-[1-tri(propan-2-yl)silyloxyethyl]phenyl]-N-methoxycarbonyl-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]iminoethanimidothioate |
| SMILES | COC(=O)N=C(SC)/C(=N\c1ccc(-c2noc(C)n2)cc1)c1cc(OC)c(OC)c(C(C)O[Si](C(C)C)(C(C)C)C(C)C)c1 |
| InChI | InChI=1S/C33H46N4O6SSi/c1-19(2)45(20(3)4,21(5)6)43-22(7)27-17-25(18-28(39-9)30(27)40-10)29(32(44-12)36-33(38)41-11)35-26-15-13-24(14-16-26)31-34-23(8)42-37-31/h13-22H,1-12H3/b35-29-,36-32? |
| InChIKey | DZKMDQNGMQIWLT-PRIBALJUSA-N |
| XLogP | 8.96 |
| TPSA | 117.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.91 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|