C27H37FN4O3SSi — CID 87267293
2-[2-fluoro-5-methoxy-3-tri(propan-2-yl)silyloxyphenyl]-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]ethanethioamide (PubChem CID 87267293) has the molecular formula C27H37FN4O3SSi and a molecular weight of 544.77 g/mol. Its IUPAC name is 2-[2-fluoro-5-methoxy-3-tri(propan-2-yl)silyloxyphenyl]-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]ethanethioamide.
| Compound Name | 2-[2-fluoro-5-methoxy-3-tri(propan-2-yl)silyloxyphenyl]-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]ethanethioamide |
|---|---|
| PubChem CID | 87267293 |
| Molecular Formula | C27H37FN4O3SSi |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 2-[2-fluoro-5-methoxy-3-tri(propan-2-yl)silyloxyphenyl]-2-[4-(5-methyl-1,2,4-oxadiazol-3-yl)anilino]ethanethioamide |
| SMILES | COc1cc(O[Si](C(C)C)(C(C)C)C(C)C)c(F)c(C(Nc2ccc(-c3noc(C)n3)cc2)C(N)=S)c1 |
| InChI | InChI=1S/C27H37FN4O3SSi/c1-15(2)37(16(3)4,17(5)6)35-23-14-21(33-8)13-22(24(23)28)25(26(29)36)31-20-11-9-19(10-12-20)27-30-18(7)34-32-27/h9-17,25,31H,1-8H3,(H2,29,36) |
| InChIKey | KCBUYTVAHISUBA-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|