C7H9IO2 — CID 89059197
(5R,6R)-6-iodo-5-methyl-3-methylideneoxan-2-one (PubChem CID 89059197) has the molecular formula C7H9IO2 and a molecular weight of 252.05 g/mol. Its IUPAC name is (5R,6R)-6-iodo-5-methyl-3-methylideneoxan-2-one.
| Compound Name | (5R,6R)-6-iodo-5-methyl-3-methylideneoxan-2-one |
|---|---|
| PubChem CID | 89059197 |
| Molecular Formula | C7H9IO2 |
| Molecular Weight | 252.05 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | (5R,6R)-6-iodo-5-methyl-3-methylideneoxan-2-one |
| SMILES | C=C1C[C@@H](C)[C@@H](I)OC1=O |
| InChI | InChI=1S/C7H9IO2/c1-4-3-5(2)7(9)10-6(4)8/h4,6H,2-3H2,1H3/t4-,6+/m1/s1 |
| InChIKey | HRXOEIDHCFVUSY-XINAWCOVSA-N |
| XLogP | 1.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.05 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|