C22H21F3N6S — CID 89060844
2-[(2-methyl-4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-3-yl)amino]-9-(trifluoromethyl)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione (PubChem CID 89060844) has the molecular formula C22H21F3N6S and a molecular weight of 458.51 g/mol. Its IUPAC name is 2-[(2-methyl-4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-3-yl)amino]-9-(trifluoromethyl)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione.
| Compound Name | 2-[(2-methyl-4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-3-yl)amino]-9-(trifluoromethyl)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione |
|---|---|
| PubChem CID | 89060844 |
| Molecular Formula | C22H21F3N6S |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 2-[(2-methyl-4a,5,6,7,8,8a-hexahydro-1,8-naphthyridin-3-yl)amino]-9-(trifluoromethyl)-5,7-dihydropyrimido[5,4-d][1]benzazepine-6-thione |
| SMILES | CC1=NC2NCCCC2C=C1Nc1ncc2c(n1)-c1ccc(C(F)(F)F)cc1NC(=S)C2 |
| InChI | InChI=1S/C22H21F3N6S/c1-11-16(7-12-3-2-6-26-20(12)28-11)30-21-27-10-13-8-18(32)29-17-9-14(22(23,24)25)4-5-15(17)19(13)31-21/h4-5,7,9-10,12,20,26H,2-3,6,8H2,1H3,(H,29,32)(H,27,30,31) |
| InChIKey | ZJXZFDLAHPLBNE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|