C16H19ClFN3O2 — CID 89065894
N'-(4-chloro-3-fluorophenyl)-N-[(E)-3-(methylamino)-2-prop-1-en-2-ylbut-2-enyl]oxamide (PubChem CID 89065894) has the molecular formula C16H19ClFN3O2 and a molecular weight of 339.80 g/mol. Its IUPAC name is N'-(4-chloro-3-fluorophenyl)-N-[(E)-3-(methylamino)-2-prop-1-en-2-ylbut-2-enyl]oxamide.
| Compound Name | N'-(4-chloro-3-fluorophenyl)-N-[(E)-3-(methylamino)-2-prop-1-en-2-ylbut-2-enyl]oxamide |
|---|---|
| PubChem CID | 89065894 |
| Molecular Formula | C16H19ClFN3O2 |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | N'-(4-chloro-3-fluorophenyl)-N-[(E)-3-(methylamino)-2-prop-1-en-2-ylbut-2-enyl]oxamide |
| SMILES | C=C(C)/C(CNC(=O)C(=O)Nc1ccc(Cl)c(F)c1)=C(/C)NC |
| InChI | InChI=1S/C16H19ClFN3O2/c1-9(2)12(10(3)19-4)8-20-15(22)16(23)21-11-5-6-13(17)14(18)7-11/h5-7,19H,1,8H2,2-4H3,(H,20,22)(H,21,23)/b12-10- |
| InChIKey | GIOSRKIRGIOWPK-BENRWUELSA-N |
| XLogP | 2.60 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|