C13H16ClFN2O3 — CID 111798976
N-(4-chloro-3-fluorophenyl)-N'-(4-hydroxy-3-methylbutan-2-yl)oxamide (PubChem CID 111798976) has the molecular formula C13H16ClFN2O3 and a molecular weight of 302.73 g/mol. Its IUPAC name is N-(4-chloro-3-fluorophenyl)-N'-(4-hydroxy-3-methylbutan-2-yl)oxamide.
| Compound Name | N-(4-chloro-3-fluorophenyl)-N'-(4-hydroxy-3-methylbutan-2-yl)oxamide |
|---|---|
| PubChem CID | 111798976 |
| Molecular Formula | C13H16ClFN2O3 |
| Molecular Weight | 302.73 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-(4-chloro-3-fluorophenyl)-N'-(4-hydroxy-3-methylbutan-2-yl)oxamide |
| SMILES | CC(CO)C(C)NC(=O)C(=O)Nc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C13H16ClFN2O3/c1-7(6-18)8(2)16-12(19)13(20)17-9-3-4-10(14)11(15)5-9/h3-5,7-8,18H,6H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | CVPSYAFUBRFUJU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.73 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|