C16H26FN3O2 — CID 111453091
1-[3-fluoro-4-[methyl(propan-2-yl)amino]phenyl]-3-(4-hydroxy-3-methylbutan-2-yl)urea (PubChem CID 111453091) has the molecular formula C16H26FN3O2 and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-[3-fluoro-4-[methyl(propan-2-yl)amino]phenyl]-3-(4-hydroxy-3-methylbutan-2-yl)urea.
| Compound Name | 1-[3-fluoro-4-[methyl(propan-2-yl)amino]phenyl]-3-(4-hydroxy-3-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 111453091 |
| Molecular Formula | C16H26FN3O2 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1-[3-fluoro-4-[methyl(propan-2-yl)amino]phenyl]-3-(4-hydroxy-3-methylbutan-2-yl)urea |
| SMILES | CC(CO)C(C)NC(=O)Nc1ccc(N(C)C(C)C)c(F)c1 |
| InChI | InChI=1S/C16H26FN3O2/c1-10(2)20(5)15-7-6-13(8-14(15)17)19-16(22)18-12(4)11(3)9-21/h6-8,10-12,21H,9H2,1-5H3,(H2,18,19,22) |
| InChIKey | DCGBOKAAIODQHJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |