C26H24Cl2N4O3 — CID 89067918
3-[5-amino-2-(morpholine-4-carbonyl)anilino]-6-chloro-3-[(3-chlorophenyl)methyl]-1H-indol-2-one (PubChem CID 89067918) has the molecular formula C26H24Cl2N4O3 and a molecular weight of 511.41 g/mol. Its IUPAC name is 3-[5-amino-2-(morpholine-4-carbonyl)anilino]-6-chloro-3-[(3-chlorophenyl)methyl]-1H-indol-2-one.
| Compound Name | 3-[5-amino-2-(morpholine-4-carbonyl)anilino]-6-chloro-3-[(3-chlorophenyl)methyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 89067918 |
| Molecular Formula | C26H24Cl2N4O3 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 3-[5-amino-2-(morpholine-4-carbonyl)anilino]-6-chloro-3-[(3-chlorophenyl)methyl]-1H-indol-2-one |
| SMILES | Nc1ccc(C(=O)N2CCOCC2)c(NC2(Cc3cccc(Cl)c3)C(=O)Nc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C26H24Cl2N4O3/c27-17-3-1-2-16(12-17)15-26(21-7-4-18(28)13-23(21)30-25(26)34)31-22-14-19(29)5-6-20(22)24(33)32-8-10-35-11-9-32/h1-7,12-14,31H,8-11,15,29H2,(H,30,34) |
| InChIKey | NEHLGJZNKJBFRZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|