C29H31BrCl2N4O2 — CID 57479130
3-[5-bromo-2-[(3-morpholin-4-ylpropylamino)methyl]anilino]-6-chloro-3-[(3-chlorophenyl)methyl]-1H-indol-2-one (PubChem CID 57479130) has the molecular formula C29H31BrCl2N4O2 and a molecular weight of 618.40 g/mol. Its IUPAC name is 3-[5-bromo-2-[(3-morpholin-4-ylpropylamino)methyl]anilino]-6-chloro-3-[(3-chlorophenyl)methyl]-1H-indol-2-one.
| Compound Name | 3-[5-bromo-2-[(3-morpholin-4-ylpropylamino)methyl]anilino]-6-chloro-3-[(3-chlorophenyl)methyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 57479130 |
| Molecular Formula | C29H31BrCl2N4O2 |
| Molecular Weight | 618.40 g/mol |
| Exact Mass | 616.10 |
| IUPAC Name | 3-[5-bromo-2-[(3-morpholin-4-ylpropylamino)methyl]anilino]-6-chloro-3-[(3-chlorophenyl)methyl]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2C1(Cc1cccc(Cl)c1)Nc1cc(Br)ccc1CNCCCN1CCOCC1 |
| InChI | InChI=1S/C29H31BrCl2N4O2/c30-22-6-5-21(19-33-9-2-10-36-11-13-38-14-12-36)26(16-22)35-29(18-20-3-1-4-23(31)15-20)25-8-7-24(32)17-27(25)34-28(29)37/h1,3-8,15-17,33,35H,2,9-14,18-19H2,(H,34,37) |
| InChIKey | ZRMKOPBJUSXHEM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.40 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|