C22H25N3O4S2 — CID 89068385
N-[5-tert-butyl-2-methoxy-3-[[methyl(methylidene)-λ4-sulfanyl]amino]phenyl]-4-nitro-1-benzothiophene-2-carboxamide (PubChem CID 89068385) has the molecular formula C22H25N3O4S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[5-tert-butyl-2-methoxy-3-[[methyl(methylidene)-λ4-sulfanyl]amino]phenyl]-4-nitro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[5-tert-butyl-2-methoxy-3-[[methyl(methylidene)-λ4-sulfanyl]amino]phenyl]-4-nitro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 89068385 |
| Molecular Formula | C22H25N3O4S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | N-[5-tert-butyl-2-methoxy-3-[[methyl(methylidene)-λ4-sulfanyl]amino]phenyl]-4-nitro-1-benzothiophene-2-carboxamide |
| SMILES | C=S(C)Nc1cc(C(C)(C)C)cc(NC(=O)c2cc3c([N+](=O)[O-])cccc3s2)c1OC |
| InChI | InChI=1S/C22H25N3O4S2/c1-22(2,3)13-10-15(20(29-4)16(11-13)24-31(5)6)23-21(26)19-12-14-17(25(27)28)8-7-9-18(14)30-19/h7-12,24H,5H2,1-4,6H3,(H,23,26) |
| InChIKey | YEWRSDWGOVKWDF-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|