C28H37F3N4O2 — CID 89068551
ethyl (E)-2-[(R)-(4-aminophenyl)-(3-piperidin-1-ylpropylamino)methyl]-3-[3-(trifluoromethyl)anilino]but-2-enoate (PubChem CID 89068551) has the molecular formula C28H37F3N4O2 and a molecular weight of 518.62 g/mol. Its IUPAC name is ethyl (E)-2-[(R)-(4-aminophenyl)-(3-piperidin-1-ylpropylamino)methyl]-3-[3-(trifluoromethyl)anilino]but-2-enoate.
| Compound Name | ethyl (E)-2-[(R)-(4-aminophenyl)-(3-piperidin-1-ylpropylamino)methyl]-3-[3-(trifluoromethyl)anilino]but-2-enoate |
|---|---|
| PubChem CID | 89068551 |
| Molecular Formula | C28H37F3N4O2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | ethyl (E)-2-[(R)-(4-aminophenyl)-(3-piperidin-1-ylpropylamino)methyl]-3-[3-(trifluoromethyl)anilino]but-2-enoate |
| SMILES | CCOC(=O)/C(=C(\C)Nc1cccc(C(F)(F)F)c1)[C@H](NCCCN1CCCCC1)c1ccc(N)cc1 |
| InChI | InChI=1S/C28H37F3N4O2/c1-3-37-27(36)25(20(2)34-24-10-7-9-22(19-24)28(29,30)31)26(21-11-13-23(32)14-12-21)33-15-8-18-35-16-5-4-6-17-35/h7,9-14,19,26,33-34H,3-6,8,15-18,32H2,1-2H3/b25-20+/t26-/m1/s1 |
| InChIKey | NIQDRZQTUMKTQU-ZQBMCQTHSA-N |
| XLogP | 5.74 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|