C35H43Br2F3N4O3 — CID 70272643
ethyl (E)-2-[(R)-(4-aminophenyl)-[5-[3-(4-bromophenoxy)propyl-methylamino]pentylamino]methyl]-4-bromo-3-[3-(trifluoromethyl)anilino]but-2-enoate (PubChem CID 70272643) has the molecular formula C35H43Br2F3N4O3 and a molecular weight of 784.56 g/mol. Its IUPAC name is ethyl (E)-2-[(R)-(4-aminophenyl)-[5-[3-(4-bromophenoxy)propyl-methylamino]pentylamino]methyl]-4-bromo-3-[3-(trifluoromethyl)anilino]but-2-enoate.
| Compound Name | ethyl (E)-2-[(R)-(4-aminophenyl)-[5-[3-(4-bromophenoxy)propyl-methylamino]pentylamino]methyl]-4-bromo-3-[3-(trifluoromethyl)anilino]but-2-enoate |
|---|---|
| PubChem CID | 70272643 |
| Molecular Formula | C35H43Br2F3N4O3 |
| Molecular Weight | 784.56 g/mol |
| Exact Mass | 782.17 |
| IUPAC Name | ethyl (E)-2-[(R)-(4-aminophenyl)-[5-[3-(4-bromophenoxy)propyl-methylamino]pentylamino]methyl]-4-bromo-3-[3-(trifluoromethyl)anilino]but-2-enoate |
| SMILES | CCOC(=O)/C(=C(\CBr)Nc1cccc(C(F)(F)F)c1)[C@H](NCCCCCN(C)CCCOc1ccc(Br)cc1)c1ccc(N)cc1 |
| InChI | InChI=1S/C35H43Br2F3N4O3/c1-3-46-34(45)32(31(24-36)43-29-10-7-9-26(23-29)35(38,39)40)33(25-11-15-28(41)16-12-25)42-19-5-4-6-20-44(2)21-8-22-47-30-17-13-27(37)14-18-30/h7,9-18,23,33,42-43H,3-6,8,19-22,24,41H2,1-2H3/b32-31+/t33-/m1/s1 |
| InChIKey | LLXQAXVQIUVMHY-RLBJMZCESA-N |
| XLogP | 8.58 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.56 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|