C19H22BBrN2O2 — CID 89069700
CID 89069700 (PubChem CID 89069700) has the molecular formula C19H22BBrN2O2 and a molecular weight of 401.11 g/mol.
| Compound Name | CID 89069700 |
|---|---|
| PubChem CID | 89069700 |
| Molecular Formula | C19H22BBrN2O2 |
| Molecular Weight | 401.11 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | — |
| SMILES | [B]N(C)Cc1cccc(NC(=O)OC[C@H](C)c2ccc(Br)cc2C)c1 |
| InChI | InChI=1S/C19H22BBrN2O2/c1-13-9-16(21)7-8-18(13)14(2)12-25-19(24)22-17-6-4-5-15(10-17)11-23(3)20/h4-10,14H,11-12H2,1-3H3,(H,22,24)/t14-/m0/s1 |
| InChIKey | WXKHXVVUYYZLOM-AWEZNQCLSA-N |
| XLogP | 4.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.11 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|