C15H24N4O2 — CID 89069998
2-[4-(4-amino-3-methoxyphenyl)piperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 89069998) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[4-(4-amino-3-methoxyphenyl)piperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(4-amino-3-methoxyphenyl)piperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 89069998 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-[4-(4-amino-3-methoxyphenyl)piperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | COc1cc(N2CCN(CC(=O)N(C)C)CC2)ccc1N |
| InChI | InChI=1S/C15H24N4O2/c1-17(2)15(20)11-18-6-8-19(9-7-18)12-4-5-13(16)14(10-12)21-3/h4-5,10H,6-9,11,16H2,1-3H3 |
| InChIKey | RVHRHOFMGYADGM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|