C8H9FO — CID 89073530
1-(6-fluorocyclohexa-1,3-dien-1-yl)ethanone (PubChem CID 89073530) has the molecular formula C8H9FO and a molecular weight of 140.16 g/mol. Its IUPAC name is 1-(6-fluorocyclohexa-1,3-dien-1-yl)ethanone.
| Compound Name | 1-(6-fluorocyclohexa-1,3-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 89073530 |
| Molecular Formula | C8H9FO |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1-(6-fluorocyclohexa-1,3-dien-1-yl)ethanone |
| SMILES | CC(=O)C1=CC=CCC1F |
| InChI | InChI=1S/C8H9FO/c1-6(10)7-4-2-3-5-8(7)9/h2-4,8H,5H2,1H3 |
| InChIKey | AIANHRRPOCDGOF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |