C27H28FN5O — CID 89073580
5-[(4-fluorophenyl)methyl]-3-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-1-pent-4-enyl-1,2,4-triazole (PubChem CID 89073580) has the molecular formula C27H28FN5O and a molecular weight of 457.55 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methyl]-3-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-1-pent-4-enyl-1,2,4-triazole.
| Compound Name | 5-[(4-fluorophenyl)methyl]-3-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-1-pent-4-enyl-1,2,4-triazole |
|---|---|
| PubChem CID | 89073580 |
| Molecular Formula | C27H28FN5O |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 5-[(4-fluorophenyl)methyl]-3-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-1-pent-4-enyl-1,2,4-triazole |
| SMILES | C=CCCCn1nc(/C=C/c2ccc(-n3cnc(C)c3)c(OC)c2)nc1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C27H28FN5O/c1-4-5-6-15-33-27(17-22-7-11-23(28)12-8-22)30-26(31-33)14-10-21-9-13-24(25(16-21)34-3)32-18-20(2)29-19-32/h4,7-14,16,18-19H,1,5-6,15,17H2,2-3H3/b14-10+ |
| InChIKey | HXQFSWKIWYVHLF-GXDHUFHOSA-N |
| XLogP | 5.65 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|