C21H22BN3O4S — CID 89075726
CID 89075726 (PubChem CID 89075726) has the molecular formula C21H22BN3O4S and a molecular weight of 423.30 g/mol.
| Compound Name | CID 89075726 |
|---|---|
| PubChem CID | 89075726 |
| Molecular Formula | C21H22BN3O4S |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)NC2CC(=O)N(c3ccc(C(=O)N4CCOCC4)c(C)c3)C2)s1 |
| InChI | InChI=1S/C21H22BN3O4S/c1-13-10-15(2-3-16(13)21(28)24-6-8-29-9-7-24)25-12-14(11-19(25)26)23-20(27)17-4-5-18(22)30-17/h2-5,10,14H,6-9,11-12H2,1H3,(H,23,27) |
| InChIKey | CXVPVPYTQQOJBY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|