C23H27BN4O3S — CID 89075743
CID 89075743 (PubChem CID 89075743) has the molecular formula C23H27BN4O3S and a molecular weight of 450.37 g/mol.
| Compound Name | CID 89075743 |
|---|---|
| PubChem CID | 89075743 |
| Molecular Formula | C23H27BN4O3S |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)NC2CC(=O)N(c3ccc(C(=O)N4CCCCC4CN)c(C)c3)C2)s1 |
| InChI | InChI=1S/C23H27BN4O3S/c1-14-10-16(5-6-18(14)23(31)27-9-3-2-4-17(27)12-25)28-13-15(11-21(28)29)26-22(30)19-7-8-20(24)32-19/h5-8,10,15,17H,2-4,9,11-13,25H2,1H3,(H,26,30) |
| InChIKey | KVWQYYPPKVXNBP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|