C13H19IN2O7 — CID 89080733
1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(2R)-3-iodo-2-methoxypropyl]pyrimidine-2,4-dione (PubChem CID 89080733) has the molecular formula C13H19IN2O7 and a molecular weight of 442.21 g/mol. Its IUPAC name is 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(2R)-3-iodo-2-methoxypropyl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(2R)-3-iodo-2-methoxypropyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 89080733 |
| Molecular Formula | C13H19IN2O7 |
| Molecular Weight | 442.21 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 1-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-[(2R)-3-iodo-2-methoxypropyl]pyrimidine-2,4-dione |
| SMILES | CO[C@@H](CI)Cc1cn([C@@H]2O[C@H](CO)C(O)[C@@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H19IN2O7/c1-22-7(3-14)2-6-4-16(13(21)15-11(6)20)12-10(19)9(18)8(5-17)23-12/h4,7-10,12,17-19H,2-3,5H2,1H3,(H,15,20,21)/t7-,8-,9?,10+,12-/m1/s1 |
| InChIKey | AUPMEXOQJBTOOE-KUFGCQGHSA-N |
| XLogP | -1.86 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.21 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|