C12H17IN2O7 — CID 46876830
1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-iodo-1-methoxyethyl)pyrimidine-2,4-dione (PubChem CID 46876830) has the molecular formula C12H17IN2O7 and a molecular weight of 428.18 g/mol. Its IUPAC name is 1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-iodo-1-methoxyethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-iodo-1-methoxyethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 46876830 |
| Molecular Formula | C12H17IN2O7 |
| Molecular Weight | 428.18 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 1-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(2-iodo-1-methoxyethyl)pyrimidine-2,4-dione |
| SMILES | COC(CI)c1cn(C2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H17IN2O7/c1-21-6(2-13)5-3-15(12(20)14-10(5)19)11-9(18)8(17)7(4-16)22-11/h3,6-9,11,16-18H,2,4H2,1H3,(H,14,19,20)/t6?,7-,8-,9-,11?/m1/s1 |
| InChIKey | OJTJVXAUCCVCCE-PKNFABCVSA-N |
| XLogP | -1.73 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.18 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|