C12H15IN4O6 — CID 21148134
[1-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-2-iodoethyl]cyanamide (PubChem CID 21148134) has the molecular formula C12H15IN4O6 and a molecular weight of 438.18 g/mol. Its IUPAC name is [1-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-2-iodoethyl]cyanamide.
| Compound Name | [1-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-2-iodoethyl]cyanamide |
|---|---|
| PubChem CID | 21148134 |
| Molecular Formula | C12H15IN4O6 |
| Molecular Weight | 438.18 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | [1-[1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]-2-iodoethyl]cyanamide |
| SMILES | N#CNC(CI)c1cn(C2OC(CO)C(O)C2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H15IN4O6/c13-1-6(15-4-14)5-2-17(12(22)16-10(5)21)11-9(20)8(19)7(3-18)23-11/h2,6-9,11,15,18-20H,1,3H2,(H,16,21,22) |
| InChIKey | JMYZFICUJFUOFR-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.18 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|